C21H41N2O6+ — CID 101280939
bis(4-carboxybutyl)-[2-(heptanoylamino)ethyl]-(2-hydroxyethyl)azanium (PubChem CID 101280939) has the molecular formula C21H41N2O6+ and a molecular weight of 417.57 g/mol. Its IUPAC name is bis(4-carboxybutyl)-[2-(heptanoylamino)ethyl]-(2-hydroxyethyl)azanium.
| Compound Name | bis(4-carboxybutyl)-[2-(heptanoylamino)ethyl]-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 101280939 |
| Molecular Formula | C21H41N2O6+ |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | bis(4-carboxybutyl)-[2-(heptanoylamino)ethyl]-(2-hydroxyethyl)azanium |
| SMILES | CCCCCCC(=O)NCC[N+](CCO)(CCCCC(=O)O)CCCCC(=O)O |
| InChI | InChI=1S/C21H40N2O6/c1-2-3-4-5-10-19(25)22-13-16-23(17-18-24,14-8-6-11-20(26)27)15-9-7-12-21(28)29/h24H,2-18H2,1H3,(H2-,22,25,26,27,28,29)/p+1 |
| InChIKey | NFEGTGNDCBMQFP-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|