C31H57NO6 — CID 177447460
2-[[bis(2-carboxybutyl)-[(E)-hexadec-7-enyl]azaniumyl]methyl]butanoate (PubChem CID 177447460) has the molecular formula C31H57NO6 and a molecular weight of 539.80 g/mol. Its IUPAC name is 2-[[bis(2-carboxybutyl)-[(E)-hexadec-7-enyl]azaniumyl]methyl]butanoate.
| Compound Name | 2-[[bis(2-carboxybutyl)-[(E)-hexadec-7-enyl]azaniumyl]methyl]butanoate |
|---|---|
| PubChem CID | 177447460 |
| Molecular Formula | C31H57NO6 |
| Molecular Weight | 539.80 g/mol |
| Exact Mass | 539.42 |
| IUPAC Name | 2-[[bis(2-carboxybutyl)-[(E)-hexadec-7-enyl]azaniumyl]methyl]butanoate |
| SMILES | CCCCCCCC/C=C/CCCCCC[N+](CC(CC)C(=O)[O-])(CC(CC)C(=O)O)CC(CC)C(=O)O |
| InChI | InChI=1S/C31H57NO6/c1-5-9-10-11-12-13-14-15-16-17-18-19-20-21-22-32(23-26(6-2)29(33)34,24-27(7-3)30(35)36)25-28(8-4)31(37)38/h15-16,26-28H,5-14,17-25H2,1-4H3,(H2-,33,34,35,36,37,38)/b16-15+ |
| InChIKey | PTTVSOMOTGFANI-FOCLMDBBSA-N |
| XLogP | 6.06 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.80 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|