C19H33NO6 — CID 177410502
3-[bis(2-carboxyethyl)-dec-9-enylazaniumyl]propanoate (PubChem CID 177410502) has the molecular formula C19H33NO6 and a molecular weight of 371.47 g/mol. Its IUPAC name is 3-[bis(2-carboxyethyl)-dec-9-enylazaniumyl]propanoate.
| Compound Name | 3-[bis(2-carboxyethyl)-dec-9-enylazaniumyl]propanoate |
|---|---|
| PubChem CID | 177410502 |
| Molecular Formula | C19H33NO6 |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 3-[bis(2-carboxyethyl)-dec-9-enylazaniumyl]propanoate |
| SMILES | C=CCCCCCCCC[N+](CCC(=O)[O-])(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C19H33NO6/c1-2-3-4-5-6-7-8-9-13-20(14-10-17(21)22,15-11-18(23)24)16-12-19(25)26/h2H,1,3-16H2,(H2-,21,22,23,24,25,26) |
| InChIKey | JNETYQQNCDGGJP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|