About dihydroxy(oxo)titanium;tetrakis(2-hydroxyethyl)azanium
dihydroxy(oxo)titanium;tetrakis(2-hydroxyethyl)azanium (PubChem CID 87195022) has the molecular formula C8H22NO7Ti+
and a molecular weight of 292.13 g/mol. Its IUPAC name is dihydroxy(oxo)titanium;tetrakis(2-hydroxyethyl)azanium.
Molecular Properties
| Compound Name | dihydroxy(oxo)titanium;tetrakis(2-hydroxyethyl)azanium |
| PubChem CID | 87195022 |
| Molecular Formula | C8H22NO7Ti+ |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | dihydroxy(oxo)titanium;tetrakis(2-hydroxyethyl)azanium |
| SMILES | O=[Ti](O)O.OCC[N+](CCO)(CCO)CCO |
| InChI | InChI=1S/C8H20NO4.2H2O.O.Ti/c10-5-1-9(2-6-11,3-7-12)4-8-13;;;;/h10-13H,1-8H2;2*1H2;;/q+1;;;;+2/p-2 |
| InChIKey | GECISPZIWLTBAZ-UHFFFAOYSA-L |
| XLogP | -3.46 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)titanium;tetrakis(2-hydroxyethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)titanium;tetrakis(2-hydroxyethyl)azanium?
The IUPAC name of dihydroxy(oxo)titanium;tetrakis(2-hydroxyethyl)azanium (CID 87195022) is dihydroxy(oxo)titanium;tetrakis(2-hydroxyethyl)azanium.
What is the SMILES notation for dihydroxy(oxo)titanium;tetrakis(2-hydroxyethyl)azanium?
The canonical SMILES for dihydroxy(oxo)titanium;tetrakis(2-hydroxyethyl)azanium is O=[Ti](O)O.OCC[N+](CCO)(CCO)CCO.
What is the InChIKey of dihydroxy(oxo)titanium;tetrakis(2-hydroxyethyl)azanium?
The InChIKey is GECISPZIWLTBAZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H20NO4.2H2O.O.Ti/c10-5-1-9(2-6-11,3-7-12)4-8-13;;;;/h10-13H,1-8H2;2*1H2;;/q+1;;;;+2/p-2.
What are the key properties of dihydroxy(oxo)titanium;tetrakis(2-hydroxyethyl)azanium?
dihydroxy(oxo)titanium;tetrakis(2-hydroxyethyl)azanium has a molecular weight of 292.13 g/mol, XLogP of -3.46, 8 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)titanium;tetrakis(2-hydroxyethyl)azanium is sourced from PubChem (CID 87195022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).