C8H14NO7+ — CID 10331654
tris(carboxymethyl)-(2-hydroxyethyl)azanium (PubChem CID 10331654) has the molecular formula C8H14NO7+ and a molecular weight of 236.20 g/mol. Its IUPAC name is tris(carboxymethyl)-(2-hydroxyethyl)azanium.
| Compound Name | tris(carboxymethyl)-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 10331654 |
| Molecular Formula | C8H14NO7+ |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | tris(carboxymethyl)-(2-hydroxyethyl)azanium |
| SMILES | O=C(O)C[N+](CCO)(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C8H13NO7/c10-2-1-9(3-6(11)12,4-7(13)14)5-8(15)16/h10H,1-5H2,(H2-,11,12,13,14,15,16)/p+1 |
| InChIKey | KDOVSPNVJQKQMT-UHFFFAOYSA-O |
| XLogP | -1.95 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|