C8H16N2O9 — CID 173231263
azane;2-[tris(carboxymethyl)azaniumyl]acetate;hydrate (PubChem CID 173231263) has the molecular formula C8H16N2O9 and a molecular weight of 284.22 g/mol. Its IUPAC name is azane;2-[tris(carboxymethyl)azaniumyl]acetate;hydrate.
| Compound Name | azane;2-[tris(carboxymethyl)azaniumyl]acetate;hydrate |
|---|---|
| PubChem CID | 173231263 |
| Molecular Formula | C8H16N2O9 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | azane;2-[tris(carboxymethyl)azaniumyl]acetate;hydrate |
| SMILES | N.O.O=C([O-])C[N+](CC(=O)O)(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C8H11NO8.H3N.H2O/c10-5(11)1-9(2-6(12)13,3-7(14)15)4-8(16)17;;/h1-4H2,(H3-,10,11,12,13,14,15,16,17);1H3;1H2 |
| InChIKey | DSEFJRIDVXKTRH-UHFFFAOYSA-N |
| XLogP | -3.86 |
| TPSA | 218.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|