C10H17N2NaO8 — CID 173157923
sodium;azane;2-[bis(carboxymethyl)-(2-ethoxy-2-oxoethyl)azaniumyl]acetate (PubChem CID 173157923) has the molecular formula C10H17N2NaO8 and a molecular weight of 316.24 g/mol. Its IUPAC name is sodium;azane;2-[bis(carboxymethyl)-(2-ethoxy-2-oxoethyl)azaniumyl]acetate.
| Compound Name | sodium;azane;2-[bis(carboxymethyl)-(2-ethoxy-2-oxoethyl)azaniumyl]acetate |
|---|---|
| PubChem CID | 173157923 |
| Molecular Formula | C10H17N2NaO8 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | sodium;azane;2-[bis(carboxymethyl)-(2-ethoxy-2-oxoethyl)azaniumyl]acetate |
| SMILES | N.[CH2-]COC(=O)C[N+](CC(=O)[O-])(CC(=O)O)CC(=O)O.[Na+] |
| InChI | InChI=1S/C10H15NO8.H3N.Na/c1-2-19-10(18)6-11(3-7(12)13,4-8(14)15)5-9(16)17;;/h1-6H2,(H,12,13)(H,14,15)(H,16,17);1H3;/q;;+1/p-1 |
| InChIKey | NSPCZMUYBFNCDR-UHFFFAOYSA-M |
| XLogP | -5.73 |
| TPSA | 176.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | -5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|