C8H18N3O8+ — CID 87323838
azane;tetrakis(carboxymethyl)azanium (PubChem CID 87323838) has the molecular formula C8H18N3O8+ and a molecular weight of 284.25 g/mol. Its IUPAC name is azane;tetrakis(carboxymethyl)azanium.
| Compound Name | azane;tetrakis(carboxymethyl)azanium |
|---|---|
| PubChem CID | 87323838 |
| Molecular Formula | C8H18N3O8+ |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | azane;tetrakis(carboxymethyl)azanium |
| SMILES | N.N.O=C(O)C[N+](CC(=O)O)(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C8H11NO8.2H3N/c10-5(11)1-9(2-6(12)13,3-7(14)15)4-8(16)17;;/h1-4H2,(H3-,10,11,12,13,14,15,16,17);2*1H3/p+1 |
| InChIKey | JNVHJZUIBBYDCW-UHFFFAOYSA-O |
| XLogP | -1.53 |
| TPSA | 219.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|