C9H15N2O8+ — CID 87396225
azane;1-carboxyethenyl-tris(carboxymethyl)azanium (PubChem CID 87396225) has the molecular formula C9H15N2O8+ and a molecular weight of 279.23 g/mol. Its IUPAC name is azane;1-carboxyethenyl-tris(carboxymethyl)azanium.
| Compound Name | azane;1-carboxyethenyl-tris(carboxymethyl)azanium |
|---|---|
| PubChem CID | 87396225 |
| Molecular Formula | C9H15N2O8+ |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | azane;1-carboxyethenyl-tris(carboxymethyl)azanium |
| SMILES | C=C(C(=O)O)[N+](CC(=O)O)(CC(=O)O)CC(=O)O.N |
| InChI | InChI=1S/C9H11NO8.H3N/c1-5(9(17)18)10(2-6(11)12,3-7(13)14)4-8(15)16;/h1-4H2,(H3-,11,12,13,14,15,16,17,18);1H3/p+1 |
| InChIKey | SNIKYSYPLSBVAT-UHFFFAOYSA-O |
| XLogP | -1.18 |
| TPSA | 184.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|