C10H18N2O8 — CID 173074972
azane;2-[tris(carboxymethyl)azaniumyl]butanoate (PubChem CID 173074972) has the molecular formula C10H18N2O8 and a molecular weight of 294.26 g/mol. Its IUPAC name is azane;2-[tris(carboxymethyl)azaniumyl]butanoate.
| Compound Name | azane;2-[tris(carboxymethyl)azaniumyl]butanoate |
|---|---|
| PubChem CID | 173074972 |
| Molecular Formula | C10H18N2O8 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | azane;2-[tris(carboxymethyl)azaniumyl]butanoate |
| SMILES | CCC(C(=O)[O-])[N+](CC(=O)O)(CC(=O)O)CC(=O)O.N |
| InChI | InChI=1S/C10H15NO8.H3N/c1-2-6(10(18)19)11(3-7(12)13,4-8(14)15)5-9(16)17;/h6H,2-5H2,1H3,(H3-,12,13,14,15,16,17,18,19);1H3 |
| InChIKey | LLHGJMBLYGXEQY-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 187.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|