About 2-(dimethylamino)butanoic acid;2-(trimethylazaniumyl)butanoate
2-(dimethylamino)butanoic acid;2-(trimethylazaniumyl)butanoate (PubChem CID 159913511) has the molecular formula C13H28N2O4
and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-(dimethylamino)butanoic acid;2-(trimethylazaniumyl)butanoate.
Molecular Properties
| Compound Name | 2-(dimethylamino)butanoic acid;2-(trimethylazaniumyl)butanoate |
| PubChem CID | 159913511 |
| Molecular Formula | C13H28N2O4 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 2-(dimethylamino)butanoic acid;2-(trimethylazaniumyl)butanoate |
| SMILES | CCC(C(=O)O)N(C)C.CCC(C(=O)[O-])[N+](C)(C)C |
| InChI | InChI=1S/C7H15NO2.C6H13NO2/c1-5-6(7(9)10)8(2,3)4;1-4-5(6(8)9)7(2)3/h6H,5H2,1-4H3;5H,4H2,1-3H3,(H,8,9) |
| InChIKey | NXMCTCGIVMWOMS-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)butanoic acid;2-(trimethylazaniumyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)butanoic acid;2-(trimethylazaniumyl)butanoate?
The IUPAC name of 2-(dimethylamino)butanoic acid;2-(trimethylazaniumyl)butanoate (CID 159913511) is 2-(dimethylamino)butanoic acid;2-(trimethylazaniumyl)butanoate.
What is the SMILES notation for 2-(dimethylamino)butanoic acid;2-(trimethylazaniumyl)butanoate?
The canonical SMILES for 2-(dimethylamino)butanoic acid;2-(trimethylazaniumyl)butanoate is CCC(C(=O)O)N(C)C.CCC(C(=O)[O-])[N+](C)(C)C.
What is the InChIKey of 2-(dimethylamino)butanoic acid;2-(trimethylazaniumyl)butanoate?
The InChIKey is NXMCTCGIVMWOMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.C6H13NO2/c1-5-6(7(9)10)8(2,3)4;1-4-5(6(8)9)7(2)3/h6H,5H2,1-4H3;5H,4H2,1-3H3,(H,8,9).
What are the key properties of 2-(dimethylamino)butanoic acid;2-(trimethylazaniumyl)butanoate?
2-(dimethylamino)butanoic acid;2-(trimethylazaniumyl)butanoate has a molecular weight of 276.38 g/mol, XLogP of -0.37, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)butanoic acid;2-(trimethylazaniumyl)butanoate is sourced from PubChem (CID 159913511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).