C5H13Cl2NO2S — CID 88518958
(2R)-2-(dimethylamino)-3-sulfanylpropanoic acid;dihydrochloride (PubChem CID 88518958) has the molecular formula C5H13Cl2NO2S and a molecular weight of 222.14 g/mol. Its IUPAC name is (2R)-2-(dimethylamino)-3-sulfanylpropanoic acid;dihydrochloride.
| Compound Name | (2R)-2-(dimethylamino)-3-sulfanylpropanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 88518958 |
| Molecular Formula | C5H13Cl2NO2S |
| Molecular Weight | 222.14 g/mol |
| Exact Mass | 221.00 |
| IUPAC Name | (2R)-2-(dimethylamino)-3-sulfanylpropanoic acid;dihydrochloride |
| SMILES | CN(C)[C@@H](CS)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C5H11NO2S.2ClH/c1-6(2)4(3-9)5(7)8;;/h4,9H,3H2,1-2H3,(H,7,8);2*1H/t4-;;/m0../s1 |
| InChIKey | FUFAXRNRSVWMMW-FHNDMYTFSA-N |
| XLogP | 0.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.14 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|