C5H9NO3S2 — CID 175074157
2-[acetyl(sulfanyl)amino]-3-sulfanylpropanoic acid (PubChem CID 175074157) has the molecular formula C5H9NO3S2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-[acetyl(sulfanyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[acetyl(sulfanyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 175074157 |
| Molecular Formula | C5H9NO3S2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.00 |
| IUPAC Name | 2-[acetyl(sulfanyl)amino]-3-sulfanylpropanoic acid |
| SMILES | CC(=O)N(S)C(CS)C(=O)O |
| InChI | InChI=1S/C5H9NO3S2/c1-3(7)6(11)4(2-10)5(8)9/h4,10-11H,2H2,1H3,(H,8,9) |
| InChIKey | BRTRDFDODHUDMC-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|