C15H23NO3S — CID 87754326
(2R)-2-[acetyl(1-adamantyl)amino]-3-sulfanylpropanoic acid (PubChem CID 87754326) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is (2R)-2-[acetyl(1-adamantyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[acetyl(1-adamantyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87754326 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (2R)-2-[acetyl(1-adamantyl)amino]-3-sulfanylpropanoic acid |
| SMILES | CC(=O)N([C@@H](CS)C(=O)O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H23NO3S/c1-9(17)16(13(8-20)14(18)19)15-5-10-2-11(6-15)4-12(3-10)7-15/h10-13,20H,2-8H2,1H3,(H,18,19)/t10?,11?,12?,13-,15?/m0/s1 |
| InChIKey | INCCXAXHUVKZFY-MFORYBBRSA-N |
| XLogP | 2.19 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|