C7H8Cl3NO3S — CID 166761288
2-[acetyl(1,2,2-trichloroethenyl)amino]-3-sulfanylpropanoic acid (PubChem CID 166761288) has the molecular formula C7H8Cl3NO3S and a molecular weight of 292.57 g/mol. Its IUPAC name is 2-[acetyl(1,2,2-trichloroethenyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[acetyl(1,2,2-trichloroethenyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 166761288 |
| Molecular Formula | C7H8Cl3NO3S |
| Molecular Weight | 292.57 g/mol |
| Exact Mass | 290.93 |
| IUPAC Name | 2-[acetyl(1,2,2-trichloroethenyl)amino]-3-sulfanylpropanoic acid |
| SMILES | CC(=O)N(C(Cl)=C(Cl)Cl)C(CS)C(=O)O |
| InChI | InChI=1S/C7H8Cl3NO3S/c1-3(12)11(6(10)5(8)9)4(2-15)7(13)14/h4,15H,2H2,1H3,(H,13,14) |
| InChIKey | SWAMWXLZICQAKV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.57 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|