C6H10N2O4S — CID 175024501
2-[acetyl-(2-aminoacetyl)amino]-2-sulfanylacetic acid (PubChem CID 175024501) has the molecular formula C6H10N2O4S and a molecular weight of 206.22 g/mol. Its IUPAC name is 2-[acetyl-(2-aminoacetyl)amino]-2-sulfanylacetic acid.
| Compound Name | 2-[acetyl-(2-aminoacetyl)amino]-2-sulfanylacetic acid |
|---|---|
| PubChem CID | 175024501 |
| Molecular Formula | C6H10N2O4S |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 2-[acetyl-(2-aminoacetyl)amino]-2-sulfanylacetic acid |
| SMILES | CC(=O)N(C(=O)CN)C(S)C(=O)O |
| InChI | InChI=1S/C6H10N2O4S/c1-3(9)8(4(10)2-7)5(13)6(11)12/h5,13H,2,7H2,1H3,(H,11,12) |
| InChIKey | VPNHOESMIVFGHO-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|