C4H8N2O4S — CID 156903782
2-[(2-aminoacetyl)-sulfanylamino]-2-hydroxyacetic acid (PubChem CID 156903782) has the molecular formula C4H8N2O4S and a molecular weight of 180.18 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)-sulfanylamino]-2-hydroxyacetic acid.
| Compound Name | 2-[(2-aminoacetyl)-sulfanylamino]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 156903782 |
| Molecular Formula | C4H8N2O4S |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | 2-[(2-aminoacetyl)-sulfanylamino]-2-hydroxyacetic acid |
| SMILES | NCC(=O)N(S)C(O)C(=O)O |
| InChI | InChI=1S/C4H8N2O4S/c5-1-2(7)6(11)3(8)4(9)10/h3,8,11H,1,5H2,(H,9,10) |
| InChIKey | LOANRXDMIJKKQT-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|