C10H10F2N2O4 — CID 142637313
2-(N-(2-aminoacetyl)-2,4-difluoroanilino)-2-hydroxyacetic acid (PubChem CID 142637313) has the molecular formula C10H10F2N2O4 and a molecular weight of 260.20 g/mol. Its IUPAC name is 2-(N-(2-aminoacetyl)-2,4-difluoroanilino)-2-hydroxyacetic acid.
| Compound Name | 2-(N-(2-aminoacetyl)-2,4-difluoroanilino)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 142637313 |
| Molecular Formula | C10H10F2N2O4 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 2-(N-(2-aminoacetyl)-2,4-difluoroanilino)-2-hydroxyacetic acid |
| SMILES | NCC(=O)N(c1ccc(F)cc1F)C(O)C(=O)O |
| InChI | InChI=1S/C10H10F2N2O4/c11-5-1-2-7(6(12)3-5)14(8(15)4-13)9(16)10(17)18/h1-3,9,16H,4,13H2,(H,17,18) |
| InChIKey | HIIJHNMYHAGIEX-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|