About 2-aminoacetic acid;ethane-1,2-diamine;2-hydroxypropanoic acid
2-aminoacetic acid;ethane-1,2-diamine;2-hydroxypropanoic acid (PubChem CID 174737478) has the molecular formula C7H19N3O5
and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-aminoacetic acid;ethane-1,2-diamine;2-hydroxypropanoic acid.
Analyze 2-aminoacetic acid;ethane-1,2-diamine;2-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;ethane-1,2-diamine;2-hydroxypropanoic acid?
The IUPAC name of 2-aminoacetic acid;ethane-1,2-diamine;2-hydroxypropanoic acid (CID 174737478) is 2-aminoacetic acid;ethane-1,2-diamine;2-hydroxypropanoic acid.
What is the SMILES notation for 2-aminoacetic acid;ethane-1,2-diamine;2-hydroxypropanoic acid?
The canonical SMILES for 2-aminoacetic acid;ethane-1,2-diamine;2-hydroxypropanoic acid is CC(O)C(=O)O.NCC(=O)O.NCCN.
What is the InChIKey of 2-aminoacetic acid;ethane-1,2-diamine;2-hydroxypropanoic acid?
The InChIKey is DQLYSIYNSYNFPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3.C2H8N2.C2H5NO2/c1-2(4)3(5)6;3-1-2-4;3-1-2(4)5/h2,4H,1H3,(H,5,6);1-4H2;1,3H2,(H,4,5).
What are the key properties of 2-aminoacetic acid;ethane-1,2-diamine;2-hydroxypropanoic acid?
2-aminoacetic acid;ethane-1,2-diamine;2-hydroxypropanoic acid has a molecular weight of 225.24 g/mol, XLogP of -2.61, 3 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;ethane-1,2-diamine;2-hydroxypropanoic acid is sourced from PubChem (CID 174737478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).