About hydride;tetrakis(2-hydroxyethyl)azanium
hydride;tetrakis(2-hydroxyethyl)azanium (PubChem CID 18517114) has the molecular formula C8H21NO4
and a molecular weight of 195.26 g/mol. Its IUPAC name is hydride;tetrakis(2-hydroxyethyl)azanium.
Molecular Properties
| Compound Name | hydride;tetrakis(2-hydroxyethyl)azanium |
| PubChem CID | 18517114 |
| Molecular Formula | C8H21NO4 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | hydride;tetrakis(2-hydroxyethyl)azanium |
| SMILES | OCC[N+](CCO)(CCO)CCO.[H-] |
| InChI | InChI=1S/C8H20NO4.H/c10-5-1-9(2-6-11,3-7-12)4-8-13;/h10-13H,1-8H2;/q+1;-1 |
| InChIKey | GSXNRJLGMLUVIJ-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze hydride;tetrakis(2-hydroxyethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydride;tetrakis(2-hydroxyethyl)azanium?
The IUPAC name of hydride;tetrakis(2-hydroxyethyl)azanium (CID 18517114) is hydride;tetrakis(2-hydroxyethyl)azanium.
What is the SMILES notation for hydride;tetrakis(2-hydroxyethyl)azanium?
The canonical SMILES for hydride;tetrakis(2-hydroxyethyl)azanium is OCC[N+](CCO)(CCO)CCO.[H-].
What is the InChIKey of hydride;tetrakis(2-hydroxyethyl)azanium?
The InChIKey is GSXNRJLGMLUVIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20NO4.H/c10-5-1-9(2-6-11,3-7-12)4-8-13;/h10-13H,1-8H2;/q+1;-1.
What are the key properties of hydride;tetrakis(2-hydroxyethyl)azanium?
hydride;tetrakis(2-hydroxyethyl)azanium has a molecular weight of 195.26 g/mol, XLogP of -2.12, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydride;tetrakis(2-hydroxyethyl)azanium is sourced from PubChem (CID 18517114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).