About butanedioic acid;3-carboxypropyl-ethyl-dimethylazanium
butanedioic acid;3-carboxypropyl-ethyl-dimethylazanium (PubChem CID 71466365) has the molecular formula C12H24NO6+
and a molecular weight of 278.32 g/mol. Its IUPAC name is butanedioic acid;3-carboxypropyl-ethyl-dimethylazanium.
Molecular Properties
| Compound Name | butanedioic acid;3-carboxypropyl-ethyl-dimethylazanium |
| PubChem CID | 71466365 |
| Molecular Formula | C12H24NO6+ |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | butanedioic acid;3-carboxypropyl-ethyl-dimethylazanium |
| SMILES | CC[N+](C)(C)CCCC(=O)O.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C8H17NO2.C4H6O4/c1-4-9(2,3)7-5-6-8(10)11;5-3(6)1-2-4(7)8/h4-7H2,1-3H3;1-2H2,(H,5,6)(H,7,8)/p+1 |
| InChIKey | RGELZKZTNZWGFO-UHFFFAOYSA-O |
| XLogP | 0.88 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butanedioic acid;3-carboxypropyl-ethyl-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;3-carboxypropyl-ethyl-dimethylazanium?
The IUPAC name of butanedioic acid;3-carboxypropyl-ethyl-dimethylazanium (CID 71466365) is butanedioic acid;3-carboxypropyl-ethyl-dimethylazanium.
What is the SMILES notation for butanedioic acid;3-carboxypropyl-ethyl-dimethylazanium?
The canonical SMILES for butanedioic acid;3-carboxypropyl-ethyl-dimethylazanium is CC[N+](C)(C)CCCC(=O)O.O=C(O)CCC(=O)O.
What is the InChIKey of butanedioic acid;3-carboxypropyl-ethyl-dimethylazanium?
The InChIKey is RGELZKZTNZWGFO-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H17NO2.C4H6O4/c1-4-9(2,3)7-5-6-8(10)11;5-3(6)1-2-4(7)8/h4-7H2,1-3H3;1-2H2,(H,5,6)(H,7,8)/p+1.
What are the key properties of butanedioic acid;3-carboxypropyl-ethyl-dimethylazanium?
butanedioic acid;3-carboxypropyl-ethyl-dimethylazanium has a molecular weight of 278.32 g/mol, XLogP of 0.88, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;3-carboxypropyl-ethyl-dimethylazanium is sourced from PubChem (CID 71466365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).