About 2-(2-cyanoethyl)-1,1-dimethylguanidine
2-(2-cyanoethyl)-1,1-dimethylguanidine (PubChem CID 130979413) has the molecular formula C6H12N4
and a molecular weight of 140.19 g/mol. Its IUPAC name is 2-(2-cyanoethyl)-1,1-dimethylguanidine.
Molecular Properties
| Compound Name | 2-(2-cyanoethyl)-1,1-dimethylguanidine |
| PubChem CID | 130979413 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 2-(2-cyanoethyl)-1,1-dimethylguanidine |
| SMILES | CN(C)/C(N)=N/CCC#N |
| InChI | InChI=1S/C6H12N4/c1-10(2)6(8)9-5-3-4-7/h3,5H2,1-2H3,(H2,8,9) |
| InChIKey | HRWJSQLMXABYPQ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 65.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-cyanoethyl)-1,1-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyanoethyl)-1,1-dimethylguanidine?
The IUPAC name of 2-(2-cyanoethyl)-1,1-dimethylguanidine (CID 130979413) is 2-(2-cyanoethyl)-1,1-dimethylguanidine.
What is the SMILES notation for 2-(2-cyanoethyl)-1,1-dimethylguanidine?
The canonical SMILES for 2-(2-cyanoethyl)-1,1-dimethylguanidine is CN(C)/C(N)=N/CCC#N.
What is the InChIKey of 2-(2-cyanoethyl)-1,1-dimethylguanidine?
The InChIKey is HRWJSQLMXABYPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4/c1-10(2)6(8)9-5-3-4-7/h3,5H2,1-2H3,(H2,8,9).
What are the key properties of 2-(2-cyanoethyl)-1,1-dimethylguanidine?
2-(2-cyanoethyl)-1,1-dimethylguanidine has a molecular weight of 140.19 g/mol, XLogP of -0.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyanoethyl)-1,1-dimethylguanidine is sourced from PubChem (CID 130979413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).