C11H22N2 — CID 91053831
1-N-ethyl-2-N-pentylbutane-1,2-diimine (PubChem CID 91053831) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 1-N-ethyl-2-N-pentylbutane-1,2-diimine.
| Compound Name | 1-N-ethyl-2-N-pentylbutane-1,2-diimine |
|---|---|
| PubChem CID | 91053831 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1-N-ethyl-2-N-pentylbutane-1,2-diimine |
| SMILES | CCCCC/N=C(/C=N/CC)CC |
| InChI | InChI=1S/C11H22N2/c1-4-7-8-9-13-11(5-2)10-12-6-3/h10H,4-9H2,1-3H3/b12-10+,13-11+ |
| InChIKey | ZXTKZZKKLCOZQK-DCIPZJNNSA-N |
| XLogP | 3.12 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|