C9H21N3O2 — CID 107865986
1-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-propan-2-ylguanidine (PubChem CID 107865986) has the molecular formula C9H21N3O2 and a molecular weight of 203.29 g/mol. Its IUPAC name is 1-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-propan-2-ylguanidine.
| Compound Name | 1-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-propan-2-ylguanidine |
|---|---|
| PubChem CID | 107865986 |
| Molecular Formula | C9H21N3O2 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.16 |
| IUPAC Name | 1-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-propan-2-ylguanidine |
| SMILES | CCC(CO)(CO)N/C(N)=N/C(C)C |
| InChI | InChI=1S/C9H21N3O2/c1-4-9(5-13,6-14)12-8(10)11-7(2)3/h7,13-14H,4-6H2,1-3H3,(H3,10,11,12) |
| InChIKey | TYFZLFMJDTUSCM-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|