C12H26N2O3 — CID 114010603
2-(aminomethyl)-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-methylpentanamide (PubChem CID 114010603) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-methylpentanamide.
| Compound Name | 2-(aminomethyl)-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 114010603 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 2-(aminomethyl)-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-methylpentanamide |
| SMILES | CCC(CO)(CO)NC(=O)C(CN)CC(C)C |
| InChI | InChI=1S/C12H26N2O3/c1-4-12(7-15,8-16)14-11(17)10(6-13)5-9(2)3/h9-10,15-16H,4-8,13H2,1-3H3,(H,14,17) |
| InChIKey | CSDSWUKAMYWBFO-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |