C12H24N2O4 — CID 114010724
2-acetamido-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-3-methylbutanamide (PubChem CID 114010724) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-acetamido-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-3-methylbutanamide.
| Compound Name | 2-acetamido-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 114010724 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2-acetamido-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-3-methylbutanamide |
| SMILES | CCC(CO)(CO)NC(=O)C(NC(C)=O)C(C)C |
| InChI | InChI=1S/C12H24N2O4/c1-5-12(6-15,7-16)14-11(18)10(8(2)3)13-9(4)17/h8,10,15-16H,5-7H2,1-4H3,(H,13,17)(H,14,18) |
| InChIKey | LDCLQVCWQVUCBM-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |