About N-cyano-N'-propan-2-ylpropanimidamide
N-cyano-N'-propan-2-ylpropanimidamide (PubChem CID 55299461) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is N-cyano-N'-propan-2-ylpropanimidamide.
Molecular Properties
| Compound Name | N-cyano-N'-propan-2-ylpropanimidamide |
| PubChem CID | 55299461 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | N-cyano-N'-propan-2-ylpropanimidamide |
| SMILES | CC/C(=N\C(C)C)NC#N |
| InChI | InChI=1S/C7H13N3/c1-4-7(9-5-8)10-6(2)3/h6H,4H2,1-3H3,(H,9,10) |
| InChIKey | QEYSWDZHJLZVLL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-cyano-N'-propan-2-ylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyano-N'-propan-2-ylpropanimidamide?
The IUPAC name of N-cyano-N'-propan-2-ylpropanimidamide (CID 55299461) is N-cyano-N'-propan-2-ylpropanimidamide.
What is the SMILES notation for N-cyano-N'-propan-2-ylpropanimidamide?
The canonical SMILES for N-cyano-N'-propan-2-ylpropanimidamide is CC/C(=N\C(C)C)NC#N.
What is the InChIKey of N-cyano-N'-propan-2-ylpropanimidamide?
The InChIKey is QEYSWDZHJLZVLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3/c1-4-7(9-5-8)10-6(2)3/h6H,4H2,1-3H3,(H,9,10).
What are the key properties of N-cyano-N'-propan-2-ylpropanimidamide?
N-cyano-N'-propan-2-ylpropanimidamide has a molecular weight of 139.20 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyano-N'-propan-2-ylpropanimidamide is sourced from PubChem (CID 55299461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).