About [(Z)-1,2-dicyano-2-(cyanoamino)ethenyl]cyanamide
[(Z)-1,2-dicyano-2-(cyanoamino)ethenyl]cyanamide (PubChem CID 132595102) has the molecular formula C6H2N6
and a molecular weight of 158.12 g/mol. Its IUPAC name is [(Z)-1,2-dicyano-2-(cyanoamino)ethenyl]cyanamide.
Molecular Properties
| Compound Name | [(Z)-1,2-dicyano-2-(cyanoamino)ethenyl]cyanamide |
| PubChem CID | 132595102 |
| Molecular Formula | C6H2N6 |
| Molecular Weight | 158.12 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | [(Z)-1,2-dicyano-2-(cyanoamino)ethenyl]cyanamide |
| SMILES | N#CN/C(C#N)=C(/C#N)NC#N |
| InChI | InChI=1S/C6H2N6/c7-1-5(11-3-9)6(2-8)12-4-10/h11-12H/b6-5- |
| InChIKey | TZOUEEKBXAYAGD-WAYWQWQTSA-N |
| XLogP | -0.61 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.12 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-1,2-dicyano-2-(cyanoamino)ethenyl]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1,2-dicyano-2-(cyanoamino)ethenyl]cyanamide?
The IUPAC name of [(Z)-1,2-dicyano-2-(cyanoamino)ethenyl]cyanamide (CID 132595102) is [(Z)-1,2-dicyano-2-(cyanoamino)ethenyl]cyanamide.
What is the SMILES notation for [(Z)-1,2-dicyano-2-(cyanoamino)ethenyl]cyanamide?
The canonical SMILES for [(Z)-1,2-dicyano-2-(cyanoamino)ethenyl]cyanamide is N#CN/C(C#N)=C(/C#N)NC#N.
What is the InChIKey of [(Z)-1,2-dicyano-2-(cyanoamino)ethenyl]cyanamide?
The InChIKey is TZOUEEKBXAYAGD-WAYWQWQTSA-N. The full InChI is InChI=1S/C6H2N6/c7-1-5(11-3-9)6(2-8)12-4-10/h11-12H/b6-5-.
What are the key properties of [(Z)-1,2-dicyano-2-(cyanoamino)ethenyl]cyanamide?
[(Z)-1,2-dicyano-2-(cyanoamino)ethenyl]cyanamide has a molecular weight of 158.12 g/mol, XLogP of -0.61, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1,2-dicyano-2-(cyanoamino)ethenyl]cyanamide is sourced from PubChem (CID 132595102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).