C6H15N3 — CID 58687650
1,3-diethyl-2-methylguanidine (PubChem CID 58687650) has the molecular formula C6H15N3 and a molecular weight of 129.21 g/mol. Its IUPAC name is 1,3-diethyl-2-methylguanidine.
| Compound Name | 1,3-diethyl-2-methylguanidine |
|---|---|
| PubChem CID | 58687650 |
| Molecular Formula | C6H15N3 |
| Molecular Weight | 129.21 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | 1,3-diethyl-2-methylguanidine |
| SMILES | CCNC(=NC)NCC |
| InChI | InChI=1S/C6H15N3/c1-4-8-6(7-3)9-5-2/h4-5H2,1-3H3,(H2,7,8,9) |
| InChIKey | DCNSLAZHSCQZOW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|