C10H15N3 — CID 140989198
1-ethyl-2-methyl-3-phenylguanidine (PubChem CID 140989198) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-ethyl-2-methyl-3-phenylguanidine.
| Compound Name | 1-ethyl-2-methyl-3-phenylguanidine |
|---|---|
| PubChem CID | 140989198 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1-ethyl-2-methyl-3-phenylguanidine |
| SMILES | CCN/C(=N\C)Nc1ccccc1 |
| InChI | InChI=1S/C10H15N3/c1-3-12-10(11-2)13-9-7-5-4-6-8-9/h4-8H,3H2,1-2H3,(H2,11,12,13) |
| InChIKey | GNGHSYBAPYMPMO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|