C12H24N2 — CID 139334741
N',2,3-trimethyl-N-[(Z)-2-methylbut-1-enyl]butanimidamide (PubChem CID 139334741) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N',2,3-trimethyl-N-[(Z)-2-methylbut-1-enyl]butanimidamide.
| Compound Name | N',2,3-trimethyl-N-[(Z)-2-methylbut-1-enyl]butanimidamide |
|---|---|
| PubChem CID | 139334741 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N',2,3-trimethyl-N-[(Z)-2-methylbut-1-enyl]butanimidamide |
| SMILES | CC/C(C)=C\N/C(=N\C)C(C)C(C)C |
| InChI | InChI=1S/C12H24N2/c1-7-10(4)8-14-12(13-6)11(5)9(2)3/h8-9,11H,7H2,1-6H3,(H,13,14)/b10-8- |
| InChIKey | SDSTYXYVBGUWRT-NTMALXAHSA-N |
| XLogP | 3.21 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|