C10H18N2O3 — CID 108914495
ethyl 2-[[(E)-2-methylbut-1-enyl]carbamoylamino]acetate (PubChem CID 108914495) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is ethyl 2-[[(E)-2-methylbut-1-enyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[(E)-2-methylbut-1-enyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 108914495 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | ethyl 2-[[(E)-2-methylbut-1-enyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)N/C=C(\C)CC |
| InChI | InChI=1S/C10H18N2O3/c1-4-8(3)6-11-10(14)12-7-9(13)15-5-2/h6H,4-5,7H2,1-3H3,(H2,11,12,14)/b8-6+ |
| InChIKey | MSVWADUMTBOLKI-SOFGYWHQSA-N |
| XLogP | 1.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |