C11H16N2O6 — CID 5358578
ethyl 2-[[(Z)-4-(ethoxycarbonylamino)-4-oxobut-2-enoyl]amino]acetate (PubChem CID 5358578) has the molecular formula C11H16N2O6 and a molecular weight of 272.26 g/mol. Its IUPAC name is ethyl 2-[[(Z)-4-(ethoxycarbonylamino)-4-oxobut-2-enoyl]amino]acetate.
| Compound Name | ethyl 2-[[(Z)-4-(ethoxycarbonylamino)-4-oxobut-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 5358578 |
| Molecular Formula | C11H16N2O6 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | ethyl 2-[[(Z)-4-(ethoxycarbonylamino)-4-oxobut-2-enoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)/C=C\C(=O)NC(=O)OCC |
| InChI | InChI=1S/C11H16N2O6/c1-3-18-10(16)7-12-8(14)5-6-9(15)13-11(17)19-4-2/h5-6H,3-4,7H2,1-2H3,(H,12,14)(H,13,15,17)/b6-5- |
| InChIKey | HRSGCZYMFXPZOG-WAYWQWQTSA-N |
| XLogP | -0.51 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|