C12H24N2O3 — CID 108914394
1,1-bis(2-methoxyethyl)-3-[(E)-2-methylbut-1-enyl]urea (PubChem CID 108914394) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 1,1-bis(2-methoxyethyl)-3-[(E)-2-methylbut-1-enyl]urea.
| Compound Name | 1,1-bis(2-methoxyethyl)-3-[(E)-2-methylbut-1-enyl]urea |
|---|---|
| PubChem CID | 108914394 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 1,1-bis(2-methoxyethyl)-3-[(E)-2-methylbut-1-enyl]urea |
| SMILES | CC/C(C)=C/NC(=O)N(CCOC)CCOC |
| InChI | InChI=1S/C12H24N2O3/c1-5-11(2)10-13-12(15)14(6-8-16-3)7-9-17-4/h10H,5-9H2,1-4H3,(H,13,15)/b11-10+ |
| InChIKey | BKGPXLFCYJYIRX-ZHACJKMWSA-N |
| XLogP | 1.60 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |