C12H20N2O6 — CID 76910282
4-[[2-methoxyethyl(3-methoxypropyl)carbamoyl]amino]-4-oxobut-2-enoic acid (PubChem CID 76910282) has the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. Its IUPAC name is 4-[[2-methoxyethyl(3-methoxypropyl)carbamoyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[2-methoxyethyl(3-methoxypropyl)carbamoyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76910282 |
| Molecular Formula | C12H20N2O6 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 4-[[2-methoxyethyl(3-methoxypropyl)carbamoyl]amino]-4-oxobut-2-enoic acid |
| SMILES | COCCCN(CCOC)C(=O)NC(=O)C=CC(=O)O |
| InChI | InChI=1S/C12H20N2O6/c1-19-8-3-6-14(7-9-20-2)12(18)13-10(15)4-5-11(16)17/h4-5H,3,6-9H2,1-2H3,(H,16,17)(H,13,15,18) |
| InChIKey | SNSXFHLMEXKECC-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|