C8H17N3O4 — CID 61418318
2-hydrazinyl-N,N-bis(2-methoxyethyl)-2-oxoacetamide (PubChem CID 61418318) has the molecular formula C8H17N3O4 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-hydrazinyl-N,N-bis(2-methoxyethyl)-2-oxoacetamide.
| Compound Name | 2-hydrazinyl-N,N-bis(2-methoxyethyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 61418318 |
| Molecular Formula | C8H17N3O4 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 2-hydrazinyl-N,N-bis(2-methoxyethyl)-2-oxoacetamide |
| SMILES | COCCN(CCOC)C(=O)C(=O)NN |
| InChI | InChI=1S/C8H17N3O4/c1-14-5-3-11(4-6-15-2)8(13)7(12)10-9/h3-6,9H2,1-2H3,(H,10,12) |
| InChIKey | SBOIKVGJCGKWIP-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|