C6H12N4O3 — CID 103103739
N-(2-amino-2-oxoethyl)-N-ethyl-2-hydrazinyl-2-oxoacetamide (PubChem CID 103103739) has the molecular formula C6H12N4O3 and a molecular weight of 188.19 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N-ethyl-2-hydrazinyl-2-oxoacetamide.
| Compound Name | N-(2-amino-2-oxoethyl)-N-ethyl-2-hydrazinyl-2-oxoacetamide |
|---|---|
| PubChem CID | 103103739 |
| Molecular Formula | C6H12N4O3 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N-ethyl-2-hydrazinyl-2-oxoacetamide |
| SMILES | CCN(CC(N)=O)C(=O)C(=O)NN |
| InChI | InChI=1S/C6H12N4O3/c1-2-10(3-4(7)11)6(13)5(12)9-8/h2-3,8H2,1H3,(H2,7,11)(H,9,12) |
| InChIKey | HOHKGBHRCACOQE-UHFFFAOYSA-N |
| XLogP | -2.69 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|