C9H19N3O2 — CID 103102003
3-amino-N-(2-amino-2-oxoethyl)-N-ethyl-3-methylbutanamide (PubChem CID 103102003) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-amino-N-(2-amino-2-oxoethyl)-N-ethyl-3-methylbutanamide.
| Compound Name | 3-amino-N-(2-amino-2-oxoethyl)-N-ethyl-3-methylbutanamide |
|---|---|
| PubChem CID | 103102003 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 3-amino-N-(2-amino-2-oxoethyl)-N-ethyl-3-methylbutanamide |
| SMILES | CCN(CC(N)=O)C(=O)CC(C)(C)N |
| InChI | InChI=1S/C9H19N3O2/c1-4-12(6-7(10)13)8(14)5-9(2,3)11/h4-6,11H2,1-3H3,(H2,10,13) |
| InChIKey | JPGMUXKFTAUHPU-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |