C9H17ClN2O2 — CID 103101636
N-(2-amino-2-oxoethyl)-3-chloro-N-ethyl-2,2-dimethylpropanamide (PubChem CID 103101636) has the molecular formula C9H17ClN2O2 and a molecular weight of 220.70 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-chloro-N-ethyl-2,2-dimethylpropanamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-chloro-N-ethyl-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 103101636 |
| Molecular Formula | C9H17ClN2O2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-chloro-N-ethyl-2,2-dimethylpropanamide |
| SMILES | CCN(CC(N)=O)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C9H17ClN2O2/c1-4-12(5-7(11)13)8(14)9(2,3)6-10/h4-6H2,1-3H3,(H2,11,13) |
| InChIKey | AFIRXJDEOGBLJK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|