C9H16N4O5 — CID 62923700
2-[bis(2-amino-2-oxoethyl)carbamoyl-ethylamino]acetic acid (PubChem CID 62923700) has the molecular formula C9H16N4O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-[bis(2-amino-2-oxoethyl)carbamoyl-ethylamino]acetic acid.
| Compound Name | 2-[bis(2-amino-2-oxoethyl)carbamoyl-ethylamino]acetic acid |
|---|---|
| PubChem CID | 62923700 |
| Molecular Formula | C9H16N4O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-[bis(2-amino-2-oxoethyl)carbamoyl-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C(=O)N(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C9H16N4O5/c1-2-12(5-8(16)17)9(18)13(3-6(10)14)4-7(11)15/h2-5H2,1H3,(H2,10,14)(H2,11,15)(H,16,17) |
| InChIKey | FOMQZTRCMDWWBT-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 147.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |