C11H18N2O7 — CID 63644812
2-[carboxymethyl-[(2-ethoxy-2-oxoethyl)-ethylcarbamoyl]amino]acetic acid (PubChem CID 63644812) has the molecular formula C11H18N2O7 and a molecular weight of 290.27 g/mol. Its IUPAC name is 2-[carboxymethyl-[(2-ethoxy-2-oxoethyl)-ethylcarbamoyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[(2-ethoxy-2-oxoethyl)-ethylcarbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 63644812 |
| Molecular Formula | C11H18N2O7 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-[carboxymethyl-[(2-ethoxy-2-oxoethyl)-ethylcarbamoyl]amino]acetic acid |
| SMILES | CCOC(=O)CN(CC)C(=O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C11H18N2O7/c1-3-12(7-10(18)20-4-2)11(19)13(5-8(14)15)6-9(16)17/h3-7H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | QVFQUJOMXGIXHW-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |