C10H16N4O5 — CID 79285413
2-[bis(2-amino-2-oxoethyl)carbamoyl-prop-2-enylamino]acetic acid (PubChem CID 79285413) has the molecular formula C10H16N4O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is 2-[bis(2-amino-2-oxoethyl)carbamoyl-prop-2-enylamino]acetic acid.
| Compound Name | 2-[bis(2-amino-2-oxoethyl)carbamoyl-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79285413 |
| Molecular Formula | C10H16N4O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-[bis(2-amino-2-oxoethyl)carbamoyl-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)C(=O)N(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C10H16N4O5/c1-2-3-13(6-9(17)18)10(19)14(4-7(11)15)5-8(12)16/h2H,1,3-6H2,(H2,11,15)(H2,12,16)(H,17,18) |
| InChIKey | YEGFHALKEMQPON-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 147.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|