C8H13N3O4 — CID 79275995
2-[(2-amino-2-oxoethyl)carbamoyl-prop-2-enylamino]acetic acid (PubChem CID 79275995) has the molecular formula C8H13N3O4 and a molecular weight of 215.21 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)carbamoyl-prop-2-enylamino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)carbamoyl-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79275995 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)carbamoyl-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)C(=O)NCC(N)=O |
| InChI | InChI=1S/C8H13N3O4/c1-2-3-11(5-7(13)14)8(15)10-4-6(9)12/h2H,1,3-5H2,(H2,9,12)(H,10,15)(H,13,14) |
| InChIKey | KFLYMSLCGUCVLO-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|