C10H13N3O3S — CID 79276375
2-[prop-2-enyl(1,3-thiazol-2-ylmethylcarbamoyl)amino]acetic acid (PubChem CID 79276375) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is 2-[prop-2-enyl(1,3-thiazol-2-ylmethylcarbamoyl)amino]acetic acid.
| Compound Name | 2-[prop-2-enyl(1,3-thiazol-2-ylmethylcarbamoyl)amino]acetic acid |
|---|---|
| PubChem CID | 79276375 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-[prop-2-enyl(1,3-thiazol-2-ylmethylcarbamoyl)amino]acetic acid |
| SMILES | C=CCN(CC(=O)O)C(=O)NCc1nccs1 |
| InChI | InChI=1S/C10H13N3O3S/c1-2-4-13(7-9(14)15)10(16)12-6-8-11-3-5-17-8/h2-3,5H,1,4,6-7H2,(H,12,16)(H,14,15) |
| InChIKey | XGTNWTKAORNDJX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|