C6H8NNaO4 — CID 90169836
sodium N-(carboxymethyl)-N-prop-2-enylcarbamate (PubChem CID 90169836) has the molecular formula C6H8NNaO4 and a molecular weight of 181.12 g/mol. Its IUPAC name is sodium N-(carboxymethyl)-N-prop-2-enylcarbamate.
| Compound Name | sodium N-(carboxymethyl)-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 90169836 |
| Molecular Formula | C6H8NNaO4 |
| Molecular Weight | 181.12 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | sodium N-(carboxymethyl)-N-prop-2-enylcarbamate |
| SMILES | C=CCN(CC(=O)O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H9NO4.Na/c1-2-3-7(6(10)11)4-5(8)9;/h2H,1,3-4H2,(H,8,9)(H,10,11);/q;+1/p-1 |
| InChIKey | CCKWMSAABZOCKH-UHFFFAOYSA-M |
| XLogP | -4.09 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.12 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|