C8H15N3O4 — CID 107435153
2-[(2-amino-2-oxoethyl)-[ethyl(methyl)carbamoyl]amino]acetic acid (PubChem CID 107435153) has the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[ethyl(methyl)carbamoyl]amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[ethyl(methyl)carbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 107435153 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[ethyl(methyl)carbamoyl]amino]acetic acid |
| SMILES | CCN(C)C(=O)N(CC(N)=O)CC(=O)O |
| InChI | InChI=1S/C8H15N3O4/c1-3-10(2)8(15)11(4-6(9)12)5-7(13)14/h3-5H2,1-2H3,(H2,9,12)(H,13,14) |
| InChIKey | ALCNYMZWBDAOQR-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |