C11H19N3O6 — CID 107438458
2-[(2-amino-2-oxoethyl)-[(4-methoxy-4-oxobutyl)-methylcarbamoyl]amino]acetic acid (PubChem CID 107438458) has the molecular formula C11H19N3O6 and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[(4-methoxy-4-oxobutyl)-methylcarbamoyl]amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[(4-methoxy-4-oxobutyl)-methylcarbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 107438458 |
| Molecular Formula | C11H19N3O6 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[(4-methoxy-4-oxobutyl)-methylcarbamoyl]amino]acetic acid |
| SMILES | COC(=O)CCCN(C)C(=O)N(CC(N)=O)CC(=O)O |
| InChI | InChI=1S/C11H19N3O6/c1-13(5-3-4-10(18)20-2)11(19)14(6-8(12)15)7-9(16)17/h3-7H2,1-2H3,(H2,12,15)(H,16,17) |
| InChIKey | JARWWQGRPWTPIF-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |