C12H22N4O5 — CID 107438237
2-[(2-amino-2-oxoethyl)-[[2-(diethylamino)-2-oxoethyl]-methylcarbamoyl]amino]acetic acid (PubChem CID 107438237) has the molecular formula C12H22N4O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[[2-(diethylamino)-2-oxoethyl]-methylcarbamoyl]amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[[2-(diethylamino)-2-oxoethyl]-methylcarbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 107438237 |
| Molecular Formula | C12H22N4O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[[2-(diethylamino)-2-oxoethyl]-methylcarbamoyl]amino]acetic acid |
| SMILES | CCN(CC)C(=O)CN(C)C(=O)N(CC(N)=O)CC(=O)O |
| InChI | InChI=1S/C12H22N4O5/c1-4-15(5-2)10(18)7-14(3)12(21)16(6-9(13)17)8-11(19)20/h4-8H2,1-3H3,(H2,13,17)(H,19,20) |
| InChIKey | SELNYDNDPNXRPP-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 124.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |