C14H20ClN3O4 — CID 108516132
N-(4-amino-2-chlorophenyl)-N',N'-bis(2-methoxyethyl)oxamide (PubChem CID 108516132) has the molecular formula C14H20ClN3O4 and a molecular weight of 329.78 g/mol. Its IUPAC name is N-(4-amino-2-chlorophenyl)-N',N'-bis(2-methoxyethyl)oxamide.
| Compound Name | N-(4-amino-2-chlorophenyl)-N',N'-bis(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 108516132 |
| Molecular Formula | C14H20ClN3O4 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N-(4-amino-2-chlorophenyl)-N',N'-bis(2-methoxyethyl)oxamide |
| SMILES | COCCN(CCOC)C(=O)C(=O)Nc1ccc(N)cc1Cl |
| InChI | InChI=1S/C14H20ClN3O4/c1-21-7-5-18(6-8-22-2)14(20)13(19)17-12-4-3-10(16)9-11(12)15/h3-4,9H,5-8,16H2,1-2H3,(H,17,19) |
| InChIKey | IMCORTPXADJAIZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|