C15H21ClN2O5 — CID 108501243
N-(3-chloro-4-methoxyphenyl)-N',N'-bis(2-methoxyethyl)oxamide (PubChem CID 108501243) has the molecular formula C15H21ClN2O5 and a molecular weight of 344.80 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-N',N'-bis(2-methoxyethyl)oxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-N',N'-bis(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 108501243 |
| Molecular Formula | C15H21ClN2O5 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-N',N'-bis(2-methoxyethyl)oxamide |
| SMILES | COCCN(CCOC)C(=O)C(=O)Nc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C15H21ClN2O5/c1-21-8-6-18(7-9-22-2)15(20)14(19)17-11-4-5-13(23-3)12(16)10-11/h4-5,10H,6-9H2,1-3H3,(H,17,19) |
| InChIKey | COJFCMRZCWAATH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|